Lipids and Lipid Derivatives
Filtered Search Results
Methyl adipoyl chloride, 96%
CAS: 35444-44-1 Molecular Formula: C7H11ClO3 Molecular Weight (g/mol): 178.61 MDL Number: MFCD00013661 InChI Key: HDLGIEZOMYJKAK-UHFFFAOYSA-N Synonym: hexanedioic acid monochloride monomethyl ester,hexanoic acid, 6-chloro-6-oxo-, methyl ester,6-methoxy-6-oxohexanoyl chloride,methyl 5-chloroformyl pentanoate,5-chlorocarbonyl-pentanoic acid methyl ester,mono-methyl adipoyl chloride,5-carbomethoxyvaleryl chloride,methyl 6-chloro-6-oxocaproate,methyl adipoyl chloride PubChem CID: 520737 IUPAC Name: methyl 6-chloro-6-oxohexanoate SMILES: COC(=O)CCCCC(Cl)=O
| PubChem CID | 520737 |
|---|---|
| CAS | 35444-44-1 |
| Molecular Weight (g/mol) | 178.61 |
| MDL Number | MFCD00013661 |
| SMILES | COC(=O)CCCCC(Cl)=O |
| Synonym | hexanedioic acid monochloride monomethyl ester,hexanoic acid, 6-chloro-6-oxo-, methyl ester,6-methoxy-6-oxohexanoyl chloride,methyl 5-chloroformyl pentanoate,5-chlorocarbonyl-pentanoic acid methyl ester,mono-methyl adipoyl chloride,5-carbomethoxyvaleryl chloride,methyl 6-chloro-6-oxocaproate,methyl adipoyl chloride |
| IUPAC Name | methyl 6-chloro-6-oxohexanoate |
| InChI Key | HDLGIEZOMYJKAK-UHFFFAOYSA-N |
| Molecular Formula | C7H11ClO3 |
Citral, 95%, mixture of cis and trans
CAS: 5392-40-5 Molecular Formula: C10H16O Molecular Weight (g/mol): 152.24 MDL Number: MFCD00006997 InChI Key: WTEVQBCEXWBHNA-JXMROGBWSA-N Synonym: citral,geranial,trans-citral,3,7-dimethylocta-2,6-dienal,geranialdehyde,e-citral,citral a,2e-3,7-dimethylocta-2,6-dienal,alpha-citral,lemsyn gb PubChem CID: 638011 ChEBI: CHEBI:16980 IUPAC Name: (2E)-3,7-dimethylocta-2,6-dienal SMILES: CC(C)=CCC\C(C)=C\C=O
| PubChem CID | 638011 |
|---|---|
| CAS | 5392-40-5 |
| Molecular Weight (g/mol) | 152.24 |
| ChEBI | CHEBI:16980 |
| MDL Number | MFCD00006997 |
| SMILES | CC(C)=CCC\C(C)=C\C=O |
| Synonym | citral,geranial,trans-citral,3,7-dimethylocta-2,6-dienal,geranialdehyde,e-citral,citral a,2e-3,7-dimethylocta-2,6-dienal,alpha-citral,lemsyn gb |
| IUPAC Name | (2E)-3,7-dimethylocta-2,6-dienal |
| InChI Key | WTEVQBCEXWBHNA-JXMROGBWSA-N |
| Molecular Formula | C10H16O |
Dodecanoic acid, 98%
CAS: 143-07-7 Molecular Formula: C12H24O2 Molecular Weight (g/mol): 200.322 MDL Number: MFCD00002736 InChI Key: POULHZVOKOAJMA-UHFFFAOYSA-N Synonym: lauric acid,n-dodecanoic acid,dodecylic acid,vulvic acid,laurostearic acid,dodecoic acid,duodecylic acid,1-undecanecarboxylic acid,aliphat no. 4,neo-fat 12 PubChem CID: 3893 ChEBI: CHEBI:30805 IUPAC Name: dodecanoic acid SMILES: CCCCCCCCCCCC(=O)O
| PubChem CID | 3893 |
|---|---|
| CAS | 143-07-7 |
| Molecular Weight (g/mol) | 200.322 |
| ChEBI | CHEBI:30805 |
| MDL Number | MFCD00002736 |
| SMILES | CCCCCCCCCCCC(=O)O |
| Synonym | lauric acid,n-dodecanoic acid,dodecylic acid,vulvic acid,laurostearic acid,dodecoic acid,duodecylic acid,1-undecanecarboxylic acid,aliphat no. 4,neo-fat 12 |
| IUPAC Name | dodecanoic acid |
| InChI Key | POULHZVOKOAJMA-UHFFFAOYSA-N |
| Molecular Formula | C12H24O2 |
n-Octyl acetate, 98+%
CAS: 112-14-1 Molecular Formula: C10H20O2 Molecular Weight (g/mol): 172.27 MDL Number: MFCD00009562 InChI Key: YLYBTZIQSIBWLI-UHFFFAOYSA-N Synonym: n-octyl acetate,acetic acid, octyl ester,caprylyl acetate,1-octyl acetate,acetic acid octyl ester,octyl ethanoate,n-octanyl acetate,n-octyl ethanoate,1-octanol acetate,acetate c-8 PubChem CID: 8164 ChEBI: CHEBI:87495 IUPAC Name: octyl acetate SMILES: CCCCCCCCOC(C)=O
| PubChem CID | 8164 |
|---|---|
| CAS | 112-14-1 |
| Molecular Weight (g/mol) | 172.27 |
| ChEBI | CHEBI:87495 |
| MDL Number | MFCD00009562 |
| SMILES | CCCCCCCCOC(C)=O |
| Synonym | n-octyl acetate,acetic acid, octyl ester,caprylyl acetate,1-octyl acetate,acetic acid octyl ester,octyl ethanoate,n-octanyl acetate,n-octyl ethanoate,1-octanol acetate,acetate c-8 |
| IUPAC Name | octyl acetate |
| InChI Key | YLYBTZIQSIBWLI-UHFFFAOYSA-N |
| Molecular Formula | C10H20O2 |
Calciferol, 97%, Thermo Scientific Chemicals
CAS: 50-14-6 Molecular Formula: C28H44O Molecular Weight (g/mol): 396.66 MDL Number: MFCD00166988,MFCD11656674 InChI Key: MECHNRXZTMCUDQ-VLOQVYPSSA-N Synonym: ergocalciferol,vitamin d2,calciferol,viosterol,oleovitamin d2,ercalciol,ergorone,detalup,condocaps,crystallina PubChem CID: 134129658 IUPAC Name: (1S)-3-[2-[(1S,7aR)-1-[(2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol SMILES: CC(C)[C@@H](C)\C=C\[C@@H](C)[C@H]1CC[C@H]2\C(CCC[C@]12C)=C\C=C1/C[C@@H](O)CCC1=C
| PubChem CID | 134129658 |
|---|---|
| CAS | 50-14-6 |
| Molecular Weight (g/mol) | 396.66 |
| MDL Number | MFCD00166988,MFCD11656674 |
| SMILES | CC(C)[C@@H](C)\C=C\[C@@H](C)[C@H]1CC[C@H]2\C(CCC[C@]12C)=C\C=C1/C[C@@H](O)CCC1=C |
| Synonym | ergocalciferol,vitamin d2,calciferol,viosterol,oleovitamin d2,ercalciol,ergorone,detalup,condocaps,crystallina |
| IUPAC Name | (1S)-3-[2-[(1S,7aR)-1-[(2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
| InChI Key | MECHNRXZTMCUDQ-VLOQVYPSSA-N |
| Molecular Formula | C28H44O |
Methyl 5-chloro-5-oxovalerate, 97%
CAS: 1501-26-4 Molecular Formula: C6H9ClO3 Molecular Weight (g/mol): 164.59 MDL Number: MFCD00000756 InChI Key: JCAZSWWHFJVFPP-UHFFFAOYSA-N Synonym: methyl 4-chloroformyl butyrate,methyl 5-chloro-5-oxovalerate,methyl 4-chloroformylbutyrate,methyl5-chloro-5-oxopentanoate,5-chloro-5-oxopentanoic acid methyl ester,methyl glutaryl chloride,pentanoic acid, 5-chloro-5-oxo-, methyl ester,4-chlorocarbonyl-butyric acid methyl ester,zlchem 559,pubchem14033 PubChem CID: 73916 IUPAC Name: methyl 5-chloro-5-oxopentanoate SMILES: COC(=O)CCCC(Cl)=O
| PubChem CID | 73916 |
|---|---|
| CAS | 1501-26-4 |
| Molecular Weight (g/mol) | 164.59 |
| MDL Number | MFCD00000756 |
| SMILES | COC(=O)CCCC(Cl)=O |
| Synonym | methyl 4-chloroformyl butyrate,methyl 5-chloro-5-oxovalerate,methyl 4-chloroformylbutyrate,methyl5-chloro-5-oxopentanoate,5-chloro-5-oxopentanoic acid methyl ester,methyl glutaryl chloride,pentanoic acid, 5-chloro-5-oxo-, methyl ester,4-chlorocarbonyl-butyric acid methyl ester,zlchem 559,pubchem14033 |
| IUPAC Name | methyl 5-chloro-5-oxopentanoate |
| InChI Key | JCAZSWWHFJVFPP-UHFFFAOYSA-N |
| Molecular Formula | C6H9ClO3 |
3,3-Dimethylacrylic acid, 98%
CAS: 541-47-9 Molecular Formula: C5H8O2 Molecular Weight (g/mol): 100.117 MDL Number: MFCD00004366 InChI Key: YYPNJNDODFVZLE-UHFFFAOYSA-N Synonym: 3,3-dimethylacrylic acid,senecioic acid,3-methylcrotonic acid,3-methyl-2-butenoic acid,2-butenoic acid, 3-methyl,senecic acid,beta,beta-dimethylacrylic acid,crotonic acid, 3-methyl,beta,beta-dimethacrylic acid,beta-methylcrotonic acid PubChem CID: 10931 ChEBI: CHEBI:37127 IUPAC Name: 3-methylbut-2-enoic acid SMILES: CC(=CC(=O)O)C
| PubChem CID | 10931 |
|---|---|
| CAS | 541-47-9 |
| Molecular Weight (g/mol) | 100.117 |
| ChEBI | CHEBI:37127 |
| MDL Number | MFCD00004366 |
| SMILES | CC(=CC(=O)O)C |
| Synonym | 3,3-dimethylacrylic acid,senecioic acid,3-methylcrotonic acid,3-methyl-2-butenoic acid,2-butenoic acid, 3-methyl,senecic acid,beta,beta-dimethylacrylic acid,crotonic acid, 3-methyl,beta,beta-dimethacrylic acid,beta-methylcrotonic acid |
| IUPAC Name | 3-methylbut-2-enoic acid |
| InChI Key | YYPNJNDODFVZLE-UHFFFAOYSA-N |
| Molecular Formula | C5H8O2 |
Cortisone, 98.1%, MP Biomedicals™
CAS: 53-06-5 Molecular Formula: C21H28O5 Molecular Weight (g/mol): 360.45 MDL Number: MFCD00003610 InChI Key: MFYSYFVPBJMHGN-ZPOLXVRWSA-N Synonym: cortisone,andreson,cortisal,cortisate,cortistal,cortivite,cortogen,cortone,kendall's compound e,adrenalex PubChem CID: 222786 ChEBI: CHEBI:16962 IUPAC Name: (1R,3aS,3bS,9aR,9bS,11aS)-1-hydroxy-1-(2-hydroxyacetyl)-9a,11a-dimethyl-1H,2H,3H,3aH,3bH,4H,5H,7H,8H,9H,9aH,9bH,10H,11H,11aH-cyclopenta[a]phenanthrene-7,10-dione SMILES: C[C@]12CC(=O)[C@H]3[C@@H](CCC4=CC(=O)CC[C@]34C)[C@@H]1CC[C@]2(O)C(=O)CO
| PubChem CID | 222786 |
|---|---|
| CAS | 53-06-5 |
| Molecular Weight (g/mol) | 360.45 |
| ChEBI | CHEBI:16962 |
| MDL Number | MFCD00003610 |
| SMILES | C[C@]12CC(=O)[C@H]3[C@@H](CCC4=CC(=O)CC[C@]34C)[C@@H]1CC[C@]2(O)C(=O)CO |
| Synonym | cortisone,andreson,cortisal,cortisate,cortistal,cortivite,cortogen,cortone,kendall's compound e,adrenalex |
| IUPAC Name | (1R,3aS,3bS,9aR,9bS,11aS)-1-hydroxy-1-(2-hydroxyacetyl)-9a,11a-dimethyl-1H,2H,3H,3aH,3bH,4H,5H,7H,8H,9H,9aH,9bH,10H,11H,11aH-cyclopenta[a]phenanthrene-7,10-dione |
| InChI Key | MFYSYFVPBJMHGN-ZPOLXVRWSA-N |
| Molecular Formula | C21H28O5 |
| CAS | 2781-10-4 |
|---|---|
| MDL Number | MFCD00015261 |
2-Hydroxy-2-methylbutyric Acid, 95+%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 3739-30-8 Molecular Weight (g/mol): 118.13 g/mol
| CAS | 3739-30-8 |
|---|---|
| Molecular Weight (g/mol) | 118.13 g/mol |
2-deoxy-D-galactopyranose, MP Biomedicals™
CAS: 1949-89-9 Molecular Formula: C6H12O5 Molecular Weight (g/mol): 164.16 MDL Number: MFCD00014649 InChI Key: PMMURAAUARKVCB-ONLQHTGVNA-N Synonym: 2-deoxy-d-galactose,3r,4r,5r-3,4,5,6-tetrahydroxyhexanal,d-lyxo-hexose, 2-deoxy,unii-531k2iok5q,2-deoxy-d-lyxo-hexose,lyxo-hexose, 2-deoxy,ksc179c4l PubChem CID: 102191 ChEBI: CHEBI:27411 SMILES: OC[C@H]1OC(O)C[C@@H](O)[C@H]1O
| PubChem CID | 102191 |
|---|---|
| CAS | 1949-89-9 |
| Molecular Weight (g/mol) | 164.16 |
| ChEBI | CHEBI:27411 |
| MDL Number | MFCD00014649 |
| SMILES | OC[C@H]1OC(O)C[C@@H](O)[C@H]1O |
| Synonym | 2-deoxy-d-galactose,3r,4r,5r-3,4,5,6-tetrahydroxyhexanal,d-lyxo-hexose, 2-deoxy,unii-531k2iok5q,2-deoxy-d-lyxo-hexose,lyxo-hexose, 2-deoxy,ksc179c4l |
| InChI Key | PMMURAAUARKVCB-ONLQHTGVNA-N |
| Molecular Formula | C6H12O5 |
Mucochloric acid, 99%
CAS: 87-56-9 Molecular Formula: C4H2Cl2O3 Molecular Weight (g/mol): 168.96 MDL Number: MFCD00006966,MFCD00006966 InChI Key: LUMLZKVIXLWTCI-IHWYPQMZSA-N Synonym: mucochloric acid,2,3-dichloromaleic aldehyde acid,kyselina mukochlorova,2z-2,3-dichloro-4-oxobut-2-enoic acid,2-butenoic acid, 2,3-dichloro-4-oxo-, 2z,aldehydodichloromaleic acid,dichloromalealdehydic acid,unii-5i5877jhiw,kyselina mukochlorova czech,ccris 6597 PubChem CID: 2771871 IUPAC Name: (Z)-2,3-dichloro-4-oxobut-2-enoic acid SMILES: OC(=O)C(\Cl)=C(\Cl)C=O
| PubChem CID | 2771871 |
|---|---|
| CAS | 87-56-9 |
| Molecular Weight (g/mol) | 168.96 |
| MDL Number | MFCD00006966,MFCD00006966 |
| SMILES | OC(=O)C(\Cl)=C(\Cl)C=O |
| Synonym | mucochloric acid,2,3-dichloromaleic aldehyde acid,kyselina mukochlorova,2z-2,3-dichloro-4-oxobut-2-enoic acid,2-butenoic acid, 2,3-dichloro-4-oxo-, 2z,aldehydodichloromaleic acid,dichloromalealdehydic acid,unii-5i5877jhiw,kyselina mukochlorova czech,ccris 6597 |
| IUPAC Name | (Z)-2,3-dichloro-4-oxobut-2-enoic acid |
| InChI Key | LUMLZKVIXLWTCI-IHWYPQMZSA-N |
| Molecular Formula | C4H2Cl2O3 |
Dimethyl succinate, 98%
CAS: 106-65-0 Molecular Formula: C6H10O4 Molecular Weight (g/mol): 146.142 MDL Number: MFCD00008466 InChI Key: MUXOBHXGJLMRAB-UHFFFAOYSA-N Synonym: dimethyl succinate,methyl succinate,dimethylsuccinate,butanedioic acid, dimethyl ester,succinic acid, dimethyl ester,dbe-4 dibasic ester,methyl butanedioate,succinic acid dimethyl ester,butanedioic acid, 1,4-dimethyl ester,fema no. 2396 PubChem CID: 7820 IUPAC Name: dimethyl butanedioate SMILES: COC(=O)CCC(=O)OC
| PubChem CID | 7820 |
|---|---|
| CAS | 106-65-0 |
| Molecular Weight (g/mol) | 146.142 |
| MDL Number | MFCD00008466 |
| SMILES | COC(=O)CCC(=O)OC |
| Synonym | dimethyl succinate,methyl succinate,dimethylsuccinate,butanedioic acid, dimethyl ester,succinic acid, dimethyl ester,dbe-4 dibasic ester,methyl butanedioate,succinic acid dimethyl ester,butanedioic acid, 1,4-dimethyl ester,fema no. 2396 |
| IUPAC Name | dimethyl butanedioate |
| InChI Key | MUXOBHXGJLMRAB-UHFFFAOYSA-N |
| Molecular Formula | C6H10O4 |
Behenyl Alcohol, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 661-19-8 Molecular Weight (g/mol): 326.6 g/mol
| CAS | 661-19-8 |
|---|---|
| Molecular Weight (g/mol) | 326.6 g/mol |
Palmitic acid, sodium salt, 98%
CAS: 408-35-5 Molecular Formula: C16H31NaO2 Molecular Weight (g/mol): 278.4 MDL Number: MFCD00002749 InChI Key: GGXKEBACDBNFAF-UHFFFAOYSA-M Synonym: sodium palmitate,palmitic acid sodium salt,hexadecanoic acid, sodium salt,sodium hexadecanoate,palmitic acid, sodium salt,sodium pentadecanecarboxylate,unii-jq43kp6296,hsdb 759,hexadecanoic acid sodium salt,hexadecanoic acid,sodium salt 1:1 PubChem CID: 2735111 IUPAC Name: sodium;hexadecanoate SMILES: CCCCCCCCCCCCCCCC(=O)[O-].[Na+]
| PubChem CID | 2735111 |
|---|---|
| CAS | 408-35-5 |
| Molecular Weight (g/mol) | 278.4 |
| MDL Number | MFCD00002749 |
| SMILES | CCCCCCCCCCCCCCCC(=O)[O-].[Na+] |
| Synonym | sodium palmitate,palmitic acid sodium salt,hexadecanoic acid, sodium salt,sodium hexadecanoate,palmitic acid, sodium salt,sodium pentadecanecarboxylate,unii-jq43kp6296,hsdb 759,hexadecanoic acid sodium salt,hexadecanoic acid,sodium salt 1:1 |
| IUPAC Name | sodium;hexadecanoate |
| InChI Key | GGXKEBACDBNFAF-UHFFFAOYSA-M |
| Molecular Formula | C16H31NaO2 |